EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO9 |
| Net Charge | 0 |
| Average Mass | 489.521 |
| Monoisotopic Mass | 489.19988 |
| SMILES | [H][C@]1([C@H](C)/C=C(C)/C=C/C(O)=C2/C(=O)CNC2=O)O[C@@]23O[C@]([H])(C(=O)C[C@]2(C)O[C@H](C)[C@@H]3C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C25H31NO9/c1-11(6-7-15(27)18-17(29)10-26-22(18)30)8-12(2)20-13(3)21-16(28)9-24(5)25(34-20,35-21)19(23(31)32)14(4)33-24/h6-8,12-14,19-21,27H,9-10H2,1-5H3,(H,26,30)(H,31,32)/b7-6+,11-8+,18-15+/t12-,13-,14-,19-,20-,21+,24+,25+/m1/s1 |
| InChIKey | YDAVVQGHGNWHJN-QOYUFUAZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocamycin E (CHEBI:141187) has role bacterial metabolite (CHEBI:76969) |
| nocamycin E (CHEBI:141187) is a enol (CHEBI:33823) |
| nocamycin E (CHEBI:141187) is a monocarboxylic acid (CHEBI:25384) |
| nocamycin E (CHEBI:141187) is a olefinic compound (CHEBI:78840) |
| nocamycin E (CHEBI:141187) is a organic heterotricyclic compound (CHEBI:26979) |
| nocamycin E (CHEBI:141187) is a spiroketal (CHEBI:72600) |
| nocamycin E (CHEBI:141187) is a tetramic acids (CHEBI:140155) |
| nocamycin E (CHEBI:141187) is a γ-lactam (CHEBI:74222) |
| nocamycin E (CHEBI:141187) is conjugate acid of nocamycin E(2−) (CHEBI:141048) |
| Incoming Relation(s) |
| nocamycin I (CHEBI:138066) has functional parent nocamycin E (CHEBI:141187) |
| nocamycin E(2−) (CHEBI:141048) is conjugate base of nocamycin E (CHEBI:141187) |
| IUPAC Name |
|---|
| (2R,3S,3aS,5R,6R,7S,9aS)-5-[(2R,3E,5E,7E)-7-(2,4-dioxopyrrolidin-3-ylidene)-7-hydroxy-4-methylhepta-3,5-dien-2-yl]-2,6,9a-trimethyl-8-oxooctahydro-3a,7-epoxyfuro[3,2-b]oxocine-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| (1S,2S,3R,5S,8S,9R,10R)-10-[(2R,3E,5E,7E)-7-(2,4-dioxopyrrolidin-3-ylidene)-7-hydroxy-4-methylhepta-3,5-dien-2-yl]-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecane-2-carboxylic acid | IUPAC |
| 21-demethyl-nocamycin I | ChEBI |
| Citations |
|---|