EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO9 |
| Net Charge | 0 |
| Average Mass | 503.548 |
| Monoisotopic Mass | 503.21553 |
| SMILES | [H][C@]1([C@H](C)/C=C(C)/C=C/C(O)=C2/C(=O)CNC2=O)O[C@@]23O[C@]([H])(C(=O)C[C@]2(C)O[C@H](C)[C@@H]3C(=O)OC)[C@@H]1C |
| InChI | InChI=1S/C26H33NO9/c1-12(7-8-16(28)19-18(30)11-27-23(19)31)9-13(2)21-14(3)22-17(29)10-25(5)26(35-21,36-22)20(15(4)34-25)24(32)33-6/h7-9,13-15,20-22,28H,10-11H2,1-6H3,(H,27,31)/b8-7+,12-9+,19-16+/t13-,14-,15-,20-,21-,22+,25+,26+/m1/s1 |
| InChIKey | DTURANKMSHIDDI-GMYASLLUSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocamycin I (CHEBI:138066) has functional parent nocamycin E (CHEBI:141187) |
| nocamycin I (CHEBI:138066) has role antibacterial agent (CHEBI:33282) |
| nocamycin I (CHEBI:138066) has role bacterial metabolite (CHEBI:76969) |
| nocamycin I (CHEBI:138066) is a enol (CHEBI:33823) |
| nocamycin I (CHEBI:138066) is a methyl ester (CHEBI:25248) |
| nocamycin I (CHEBI:138066) is a olefinic compound (CHEBI:78840) |
| nocamycin I (CHEBI:138066) is a organic heterotricyclic compound (CHEBI:26979) |
| nocamycin I (CHEBI:138066) is a spiroketal (CHEBI:72600) |
| nocamycin I (CHEBI:138066) is a tetramic acids (CHEBI:140155) |
| nocamycin I (CHEBI:138066) is a γ-lactam (CHEBI:74222) |
| nocamycin I (CHEBI:138066) is conjugate acid of nocamycin I(1−) (CHEBI:141049) |
| Incoming Relation(s) |
| nocamycin I(1−) (CHEBI:141049) is conjugate base of nocamycin I (CHEBI:138066) |
| IUPAC Name |
|---|
| methyl (2R,3S,3aS,5R,6R,7S,9aS)-5-[(2R,3E,5E,7E)-7-(2,4-dioxopyrrolidin-3-ylidene)-7-hydroxy-4-methylhepta-3,5-dien-2-yl]-2,6,9a-trimethyl-8-oxooctahydro-3a,7-epoxyfuro[3,2-b]oxocine-3-carboxylate |
| Synonyms | Source |
|---|---|
| Antibiotic BU 2313B | ChEBI |
| Bu-2313B | ChEBI |
| BU 2313B | ChEBI |
| methyl (1S,2S,3R,5S,8S,9R,10R)-10-[(2R,3E,5E,7E)-7-(2,4-dioxopyrrolidin-3-ylidene)-7-hydroxy-4-methylhepta-3,5-dien-2-yl]-3,5,9-trimethyl-7-oxo-4,11,12-trioxatricyclo[6.3.1.01,5]dodecane-2-carboxylate | IUPAC |
| (−)-nocamycin I | ChEBI |
| Citations |
|---|