EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18FN7O3 |
| Net Charge | 0 |
| Average Mass | 411.397 |
| Monoisotopic Mass | 411.14552 |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Oc3ncnc4nncc34)c(F)c2)no1 |
| InChI | InChI=1S/C19H18FN7O3/c1-19(2,3)14-7-15(27-30-14)25-18(28)24-10-4-5-13(12(20)6-10)29-17-11-8-23-26-16(11)21-9-22-17/h4-9H,1-3H3,(H,21,22,23,26)(H2,24,25,27,28) |
| InChIKey | HYYTZUUXIPJLRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKLB-677 (CHEBI:140875) has role tyrosine kinase inhibitor (CHEBI:38637) |
| SKLB-677 (CHEBI:140875) has role Wnt signalling inhibitor (CHEBI:78031) |
| SKLB-677 (CHEBI:140875) is a aromatic ether (CHEBI:35618) |
| SKLB-677 (CHEBI:140875) is a isoxazoles (CHEBI:55373) |
| SKLB-677 (CHEBI:140875) is a monofluorobenzenes (CHEBI:83575) |
| SKLB-677 (CHEBI:140875) is a phenylureas (CHEBI:134043) |
| SKLB-677 (CHEBI:140875) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-fluoro-4-(1H-pyrazolo[3,4-d]pyrimidin-4-yloxy)phenyl]urea |
| Citations |
|---|