EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O9 |
| Net Charge | 0 |
| Average Mass | 406.387 |
| Monoisotopic Mass | 406.12638 |
| SMILES | OC[C@H]1O[C@@H](Oc2c(O)cc(O)cc2/C=C/c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22O9/c21-9-15-16(25)17(26)18(27)20(28-15)29-19-11(7-13(23)8-14(19)24)4-1-10-2-5-12(22)6-3-10/h1-8,15-18,20-27H,9H2/b4-1+/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | JAYVHSBYKLLDJC-DSNJPTTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fallopia multiflora (ncbitaxon:7602) | - | PubMed (17963744) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role anti-inflammatory agent (CHEBI:67079) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role antioxidant (CHEBI:22586) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role apoptosis inhibitor (CHEBI:68494) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role cardioprotective agent (CHEBI:77307) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) has role platelet aggregation inhibitor (CHEBI:50427) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) is a resorcinols (CHEBI:33572) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) is a stilbenoid (CHEBI:26776) |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside (CHEBI:140850) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside | ChEBI |
| (E)-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside | ChEBI |
| trans-2,3,5,4'-tetrahydroxystilbene-2-O-β-D-glucoside | ChEBI |
| tetrahydroxystilbene glucoside | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C00015893 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:55327-45-2 | ChemIDplus |
| CAS:82373-94-2 | SUBMITTER |
| Citations |
|---|