EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 243.219 |
| Monoisotopic Mass | 243.08552 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytidine (CHEBI:17562) has functional parent cytosine (CHEBI:16040) |
| cytidine (CHEBI:17562) has role Escherichia coli metabolite (CHEBI:76971) |
| cytidine (CHEBI:17562) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| cytidine (CHEBI:17562) has role antineoplastic agent (CHEBI:35610) |
| cytidine (CHEBI:17562) has role antipsychotic agent (CHEBI:35476) |
| cytidine (CHEBI:17562) has role human metabolite (CHEBI:77746) |
| cytidine (CHEBI:17562) has role mouse metabolite (CHEBI:75771) |
| cytidine (CHEBI:17562) has role ophthalmology drug (CHEBI:66981) |
| cytidine (CHEBI:17562) is a cytidines (CHEBI:23524) |
| Incoming Relation(s) |
| N4-hydroxycytidine (CHEBI:180654) has functional parent cytidine (CHEBI:17562) |
| 3'-deoxy-3',4'-didehydro-cytidine (CHEBI:156331) has functional parent cytidine (CHEBI:17562) |
| 5-ethynylcytidine (CHEBI:228294) has functional parent cytidine (CHEBI:17562) |
| 5-formylcytidine (CHEBI:234279) has functional parent cytidine (CHEBI:17562) |
| cytidine residue (CHEBI:64656) is substituent group from cytidine (CHEBI:17562) |
| IUPAC Name |
|---|
| cytidine |
| Synonyms | Source |
|---|---|
| 1-beta-D-Ribofuranosylcytosine | HMDB |
| 1β-D-ribofuranosylcytosine | NIST Chemistry WebBook |
| 4-AMINO-1-BETA-D-RIBOFURANOSYL-2(1H)-PYRIMIDINONE | PDBeChem |
| 4-amino-1β-D-ribofuranosyl-2(1H)-pyrimidinone | NIST Chemistry WebBook |
| 4-amino-1-β-D-ribofuranosylpyrimidin-2(1H)-one | ChEBI |
| Cyd | IUBMB |
| UniProt Name | Source |
|---|---|
| cytidine | UniProt |
| Citations |
|---|