EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O4 |
| Net Charge | -1 |
| Average Mass | 359.486 |
| Monoisotopic Mass | 359.22278 |
| SMILES | CC/C=C\C[C@@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\C/C=C\CCC(=O)[O-] |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,5-13,17-18,20-21,23-24H,2,4,14-16,19H2,1H3,(H,25,26)/p-1/b7-5-,9-8+,10-3-,11-6-,17-12-,18-13+/t20-,21-/m1/s1 |
| InChIKey | CRDZYJSQHCXHEG-HBMALMRFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspirin-triggered protectin D1(1−) (CHEBI:140208) is a dihydroxydocosahexaenoate (CHEBI:136528) |
| aspirin-triggered protectin D1(1−) (CHEBI:140208) is conjugate base of aspirin-triggered protectin D1 (CHEBI:140202) |
| Incoming Relation(s) |
| aspirin-triggered protectin D1 (CHEBI:140202) is conjugate acid of aspirin-triggered protectin D1(1−) (CHEBI:140208) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
| Synonyms | Source |
|---|---|
| AT-NPD1(1−) | ChEBI |
| AT-(NPD1/PD1)(1−) | ChEBI |
| aspirin-triggered neuroprotectin D1(1−) | ChEBI |
| AT-PD1(1−) | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosahexaenoate | ChEBI |
| 10(R),17(R)-dihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoate | ChEBI |