EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:140202 - aspirin-triggered protectin D1
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,5-13,17-18,20-21,23-24H,2,4,14-16,19H2,1H3,(H,25,26)/b7-5-,9-8+,10-3-,11-6-,17-12-,18-13+/t20-,21-/m1/s1 |
| InChIKey | CRDZYJSQHCXHEG-HBMALMRFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Applications: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspirin-triggered protectin D1 (CHEBI:140202) has role anti-inflammatory agent (CHEBI:67079) |
| aspirin-triggered protectin D1 (CHEBI:140202) has role human xenobiotic metabolite (CHEBI:76967) |
| aspirin-triggered protectin D1 (CHEBI:140202) has role neuroprotective agent (CHEBI:63726) |
| aspirin-triggered protectin D1 (CHEBI:140202) has role specialised pro-resolving mediator (CHEBI:140399) |
| aspirin-triggered protectin D1 (CHEBI:140202) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| aspirin-triggered protectin D1 (CHEBI:140202) is a secondary allylic alcohol (CHEBI:134396) |
| aspirin-triggered protectin D1 (CHEBI:140202) is conjugate acid of aspirin-triggered protectin D1(1−) (CHEBI:140208) |
| Incoming Relation(s) |
| aspirin-triggered protectin D1(1−) (CHEBI:140208) is conjugate base of aspirin-triggered protectin D1 (CHEBI:140202) |
| IUPAC Name |
|---|
| (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 10(R),17(R)-dihydroxydocosa-4Z,7Z,11E,13E,15Z,19Z-hexaenoic acid | ChEBI |
| aspirin-triggered neuroprotectin D1 | ChEBI |
| AT-NPD1 | ChEBI |
| AT-(NPD1/PD1) | ChEBI |
| (4Z,7Z,10R,11E,13E,15Z,17R,19Z)-10,17-dihydroxydocosahexaenoic acid | ChEBI |
| AT-PD1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22110134 | Reaxys |
| Citations |
|---|