EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O4 |
| Net Charge | 0 |
| Average Mass | 178.188 |
| Monoisotopic Mass | 178.09536 |
| SMILES | CC(O)CN(CC(C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C6H14N2O4/c1-5(9)3-7(8(11)12)4-6(2)10/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | VDXFGTOIPOGIJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) has functional parent N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) has role carcinogenic agent (CHEBI:50903) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) is a diol (CHEBI:23824) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) is a nitramine (CHEBI:25543) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1,1'-(nitroimino)dipropan-2-ol |
| Synonym | Source |
|---|---|
| BHP | ChEBI |
| Citations |
|---|