EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | CC(O)CN(CC(C)O)N=O |
| InChI | InChI=1S/C6H14N2O3/c1-5(9)3-8(7-11)4-6(2)10/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | MNIGYIKCFSPQRJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) has role carcinogenic agent (CHEBI:50903) |
| N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) is a diol (CHEBI:23824) |
| N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) is a nitrosamine (CHEBI:35803) |
| N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| N-nitrobis(2-hydroxypropyl)amine (CHEBI:140063) has functional parent N,N-bis(2-hydroxypropyl)nitrosamine (CHEBI:131518) |
| IUPAC Name |
|---|
| N,N-bis(2-hydroxypropyl)nitrous amide |
| Synonyms | Source |
|---|---|
| 2,2'-bishydroxypropylnitrosamine | ChemIDplus |
| 2,2'-dihydroxy-di-n-propylnitrosoamine | ChemIDplus |
| DHPN | ChemIDplus |
| di(2-hydroxypropyl)nitrosamine | ChemIDplus |
| diisopropanolnitrosamine | ChemIDplus |
| N-bis(2-hydroxypropyl)nitrosamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2245909 | Reaxys |
| CAS:53609-64-6 | ChemIDplus |
| Citations |
|---|