EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23O6 |
| Net Charge | -1 |
| Average Mass | 287.332 |
| Monoisotopic Mass | 287.15001 |
| SMILES | C[C@@H]1O[C@@H](OCCCCC/C=C/C(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C14H24O6/c1-10-11(15)9-12(16)14(20-10)19-8-6-4-2-3-5-7-13(17)18/h5,7,10-12,14-16H,2-4,6,8-9H2,1H3,(H,17,18)/p-1/b7-5+/t10-,11+,12+,14+/m0/s1 |
| InChIKey | JAEJLIJYAKFZFG-YZSAPEPWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#13(1−) (CHEBI:139972) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#13(1−) (CHEBI:139972) is conjugate base of oscr#13 (CHEBI:139971) |
| Incoming Relation(s) |
| oscr#13 (CHEBI:139971) is conjugate acid of oscr#13(1−) (CHEBI:139972) |
| IUPAC Name |
|---|
| (2E)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]oct-2-enoate |