EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O6 |
| Net Charge | 0 |
| Average Mass | 288.340 |
| Monoisotopic Mass | 288.15729 |
| SMILES | C[C@@H]1O[C@@H](OCCCCC/C=C/C(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C14H24O6/c1-10-11(15)9-12(16)14(20-10)19-8-6-4-2-3-5-7-13(17)18/h5,7,10-12,14-16H,2-4,6,8-9H2,1H3,(H,17,18)/b7-5+/t10-,11+,12+,14+/m0/s1 |
| InChIKey | JAEJLIJYAKFZFG-YZSAPEPWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#13 (CHEBI:139971) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#13 (CHEBI:139971) is a monocarboxylic acid (CHEBI:25384) |
| oscr#13 (CHEBI:139971) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#13 (CHEBI:139971) is conjugate acid of oscr#13(1−) (CHEBI:139972) |
| Incoming Relation(s) |
| oscr#13-CoA (CHEBI:139973) has functional parent oscr#13 (CHEBI:139971) |
| oscr#13(1−) (CHEBI:139972) is conjugate base of oscr#13 (CHEBI:139971) |
| IUPAC Name |
|---|
| (2E)-8-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]oct-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23412683 | Reaxys |
| Citations |
|---|