EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17O7 |
| Net Charge | -1 |
| Average Mass | 261.250 |
| Monoisotopic Mass | 261.09798 |
| SMILES | C[C@@H]1O[C@@H](OCCC(=O)CC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C11H18O7/c1-6-8(13)5-9(14)11(18-6)17-3-2-7(12)4-10(15)16/h6,8-9,11,13-14H,2-5H2,1H3,(H,15,16)/p-1/t6-,8+,9+,11+/m0/s1 |
| InChIKey | XKFOFXRCSUBDPV-YXYNTAJPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bkos#9(1−) (CHEBI:139961) is a 3-oxo monocarboxylic acid anion (CHEBI:35973) |
| bkos#9(1−) (CHEBI:139961) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| bkos#9(1−) (CHEBI:139961) is conjugate base of bkos#9 (CHEBI:139960) |
| Incoming Relation(s) |
| bkos#9 (CHEBI:139960) is conjugate acid of bkos#9(1−) (CHEBI:139961) |
| IUPAC Name |
|---|
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-oxopentanoate |