EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O7 |
| Net Charge | 0 |
| Average Mass | 262.258 |
| Monoisotopic Mass | 262.10525 |
| SMILES | C[C@@H]1O[C@@H](OCCC(=O)CC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C11H18O7/c1-6-8(13)5-9(14)11(18-6)17-3-2-7(12)4-10(15)16/h6,8-9,11,13-14H,2-5H2,1H3,(H,15,16)/t6-,8+,9+,11+/m0/s1 |
| InChIKey | XKFOFXRCSUBDPV-YXYNTAJPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bkos#9 (CHEBI:139960) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| bkos#9 (CHEBI:139960) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| bkos#9 (CHEBI:139960) is conjugate acid of bkos#9(1−) (CHEBI:139961) |
| Incoming Relation(s) |
| bkos#9-CoA (CHEBI:139962) has functional parent bkos#9 (CHEBI:139960) |
| bkos#9(1−) (CHEBI:139961) is conjugate base of bkos#9 (CHEBI:139960) |
| IUPAC Name |
|---|
| 5-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-oxopentanoic acid |