EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O5 |
| Net Charge | 0 |
| Average Mass | 368.429 |
| Monoisotopic Mass | 368.16237 |
| SMILES | COc1ccc(/C=C/C(=O)c2c(OC)cc(O)c(CC=C(C)C)c2O)cc1 |
| InChI | InChI=1S/C22H24O5/c1-14(2)5-11-17-19(24)13-20(27-4)21(22(17)25)18(23)12-8-15-6-9-16(26-3)10-7-15/h5-10,12-13,24-25H,11H2,1-4H3/b12-8+ |
| InChIKey | HOOCUUOYPZNVKX-XYOKQWHBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-methylxanthohumol (CHEBI:139593) has functional parent trans-chalcone (CHEBI:48965) |
| 4-O-methylxanthohumol (CHEBI:139593) is a aromatic ether (CHEBI:35618) |
| 4-O-methylxanthohumol (CHEBI:139593) is a chalcones (CHEBI:23086) |
| 4-O-methylxanthohumol (CHEBI:139593) is a resorcinols (CHEBI:33572) |
| 4-O-methylxanthohumol (CHEBI:139593) is conjugate acid of 4-O-methylxanthohumol(1−) (CHEBI:139273) |
| Incoming Relation(s) |
| 4-O-methylxanthohumol(1−) (CHEBI:139273) is conjugate base of 4-O-methylxanthohumol (CHEBI:139593) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| UniProt Name | Source |
|---|---|
| 4-O-methylxanthohumol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10479895 | Reaxys |
| Citations |
|---|