EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23O5 |
| Net Charge | -1 |
| Average Mass | 367.421 |
| Monoisotopic Mass | 367.15510 |
| SMILES | COc1ccc(/C=C/C(=O)c2c(OC)cc(O)c(CC=C(C)C)c2[O-])cc1 |
| InChI | InChI=1S/C22H24O5/c1-14(2)5-11-17-19(24)13-20(27-4)21(22(17)25)18(23)12-8-15-6-9-16(26-3)10-7-15/h5-10,12-13,24-25H,11H2,1-4H3/p-1/b12-8+ |
| InChIKey | HOOCUUOYPZNVKX-XYOKQWHBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-methylxanthohumol(1−) (CHEBI:139273) is a phenolate anion (CHEBI:50525) |
| 4-O-methylxanthohumol(1−) (CHEBI:139273) is conjugate base of 4-O-methylxanthohumol (CHEBI:139593) |
| Incoming Relation(s) |
| 4-O-methylxanthohumol (CHEBI:139593) is conjugate acid of 4-O-methylxanthohumol(1−) (CHEBI:139273) |
| IUPAC Name |
|---|
| 3-hydroxy-5-methoxy-6-[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]-2-(3-methylbut-2-en-1-yl)phenolate |
| Citations |
|---|