EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O4S |
| Net Charge | 0 |
| Average Mass | 332.381 |
| Monoisotopic Mass | 332.08308 |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-11(19)17-13-3-7-15(8-4-13)23(21,22)16-9-5-14(6-10-16)18-12(2)20/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | AMTPYFGPPVFBBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antimicrobial drug A drug used to treat or prevent microbial infections. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antimicrobial drug A drug used to treat or prevent microbial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acedapsone (CHEBI:139474) has functional parent dapsone (CHEBI:4325) |
| acedapsone (CHEBI:139474) has role antimalarial (CHEBI:38068) |
| acedapsone (CHEBI:139474) has role antimicrobial drug (CHEBI:36043) |
| acedapsone (CHEBI:139474) is a acetamides (CHEBI:22160) |
| acedapsone (CHEBI:139474) is a anilide (CHEBI:13248) |
| acedapsone (CHEBI:139474) is a secondary carboxamide (CHEBI:140325) |
| acedapsone (CHEBI:139474) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N,N'-[sulfonyldi(4,1-phenylene)]diacetamide |
| INNs | Source |
|---|---|
| acedapsona | ChemIDplus |
| acedapsone | ChemIDplus |
| acedapsonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4',4'''-sulfonylbis(acetanilide) | ChemIDplus |
| N,N'-(sulfonyldi-4,1-phenylene)bisacetamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Acedapsone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2164071 | Reaxys |
| CAS:77-46-3 | ChemIDplus |
| Citations |
|---|