EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O4S |
| Net Charge | 0 |
| Average Mass | 332.381 |
| Monoisotopic Mass | 332.08308 |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-11(19)17-13-3-7-15(8-4-13)23(21,22)16-9-5-14(6-10-16)18-12(2)20/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | AMTPYFGPPVFBBI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial drug A drug used to treat or prevent microbial infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antimicrobial drug A drug used to treat or prevent microbial infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acedapsone (CHEBI:139474) has functional parent dapsone (CHEBI:4325) |
| acedapsone (CHEBI:139474) has role antimalarial (CHEBI:38068) |
| acedapsone (CHEBI:139474) has role antimicrobial drug (CHEBI:36043) |
| acedapsone (CHEBI:139474) is a acetamides (CHEBI:22160) |
| acedapsone (CHEBI:139474) is a anilide (CHEBI:13248) |
| acedapsone (CHEBI:139474) is a secondary carboxamide (CHEBI:140325) |
| acedapsone (CHEBI:139474) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N,N'-[sulfonyldi(4,1-phenylene)]diacetamide |
| INNs | Source |
|---|---|
| acedapsona | ChemIDplus |
| acedapsonum | ChemIDplus |
| acedapsone | ChemIDplus |
| Synonyms | Source |
|---|---|
| N,N'-(sulfonyldi-4,1-phenylene)bisacetamide | ChemIDplus |
| 4',4'''-sulfonylbis(acetanilide) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Acedapsone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2164071 | Reaxys |
| CAS:77-46-3 | ChemIDplus |
| Citations |
|---|