EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO5 |
| Net Charge | 0 |
| Average Mass | 339.432 |
| Monoisotopic Mass | 339.20457 |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[C@H]1CCC(=O)C1C/C=C\CCO)C(=O)O |
| InChI | InChI=1S/C18H29NO5/c1-3-12(2)17(18(23)24)19-16(22)11-13-8-9-15(21)14(13)7-5-4-6-10-20/h4-5,12-14,17,20H,3,6-11H2,1-2H3,(H,19,22)(H,23,24)/b5-4-/t12-,13+,14?,17-/m0/s1 |
| InChIKey | TXHIPUZLOILIIU-MJYWSMEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is a L-isoleucine derivative (CHEBI:84111) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is a fatty amide (CHEBI:29348) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is a homoallylic alcohol (CHEBI:134362) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is conjugate acid of N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) |
| Incoming Relation(s) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) is conjugate base of N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) |
| IUPAC Name |
|---|
| N-({(1R)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetyl)-L-isoleucine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26688570 | Reaxys |