EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28NO5 |
| Net Charge | -1 |
| Average Mass | 338.424 |
| Monoisotopic Mass | 338.19730 |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[C@H]1CCC(=O)C1C/C=C\CCO)C(=O)[O-] |
| InChI | InChI=1S/C18H29NO5/c1-3-12(2)17(18(23)24)19-16(22)11-13-8-9-15(21)14(13)7-5-4-6-10-20/h4-5,12-14,17,20H,3,6-11H2,1-2H3,(H,19,22)(H,23,24)/p-1/b5-4-/t12-,13+,14?,17-/m0/s1 |
| InChIKey | TXHIPUZLOILIIU-MJYWSMEFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) is a N-jasmonyl-L-α-amino acid anion (CHEBI:136183) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) is conjugate base of N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) |
| Incoming Relation(s) |
| N-[(+)-12-hydroxy-7-isojasmonyl]-L-isoleucinate (CHEBI:136181) is a N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) |
| N-[(3R)-12-hydroxyjasmonyl]-L-isoleucine (CHEBI:139301) is conjugate acid of N-[(3R)-12-hydroxyjasmonyl]-L-isoleucinate (CHEBI:138626) |
| IUPAC Name |
|---|
| (2S,3S)-2-(2-{(1R)-2-[(2Z)-5-hydroxypent-2-en-1-yl]-3-oxocyclopentyl}acetamido)-3-methylpentanoate |
| Synonym | Source |
|---|---|
| (3R)-12-hydroxyjasmonoyl-L-isoleucinate(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-isoleucine-12-hydroxyjasmonate | UniProt |
| Citations |
|---|