EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CCC(O)CC(=O)O |
| InChI | InChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | REKYPYSUBKSCAT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxypentanoic acid (CHEBI:139272) has functional parent valeric acid (CHEBI:17418) |
| 3-hydroxypentanoic acid (CHEBI:139272) is a 3-hydroxy fatty acid (CHEBI:59845) |
| 3-hydroxypentanoic acid (CHEBI:139272) is a ketone body (CHEBI:73693) |
| 3-hydroxypentanoic acid (CHEBI:139272) is a short-chain fatty acid (CHEBI:26666) |
| Incoming Relation(s) |
| O-(3-hydroxyvaleryl)-L-carnitine (CHEBI:90407) has functional parent 3-hydroxypentanoic acid (CHEBI:139272) |
| (R)-3-hydroxypentanoic acid (CHEBI:139239) is a 3-hydroxypentanoic acid (CHEBI:139272) |
| (S)-3-hydroxypentanoic acid (CHEBI:139270) is a 3-hydroxypentanoic acid (CHEBI:139272) |
| Synonyms | Source |
|---|---|
| 3-hydroxy valeric acid | LIPID MAPS |
| 3-Hydroxy-Valeric acid | HMDB |
| β-hydroxypentanoic acid | ChEBI |
| β-hydroxyvaleric acid | ChEBI |
| 3-hydroxy-pentanoic acid | LIPID MAPS |
| beta-Hydroxyvaleric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000531 | HMDB |
| LMFA01050008 | LIPID MAPS |
| 3-Hydroxypentanoic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721212 | Reaxys |
| CAS:10237-77-1 | ChemIDplus |