EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CC[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | REKYPYSUBKSCAT-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-hydroxypentanoic acid (CHEBI:139239) is a 3-hydroxypentanoic acid (CHEBI:139272) |
| (R)-3-hydroxypentanoic acid (CHEBI:139239) is conjugate acid of (R)-3-hydroxypentanoate (CHEBI:138588) |
| (R)-3-hydroxypentanoic acid (CHEBI:139239) is enantiomer of (S)-3-hydroxypentanoic acid (CHEBI:139270) |
| Incoming Relation(s) |
| (R)-3-hydroxypentanoyl-CoA (CHEBI:139236) has functional parent (R)-3-hydroxypentanoic acid (CHEBI:139239) |
| (R)-3-hydroxypentanoate (CHEBI:138588) is conjugate base of (R)-3-hydroxypentanoic acid (CHEBI:139239) |
| (S)-3-hydroxypentanoic acid (CHEBI:139270) is enantiomer of (R)-3-hydroxypentanoic acid (CHEBI:139239) |
| IUPAC Name |
|---|
| (3R)-3-hydroxypentanoic acid |
| Synonyms | Source |
|---|---|
| (3R)-3-hydroxyvaleric acid | ChEBI |
| (3R)-hydroxypentanoic acid | ChEBI |
| (3R)-hydroxyvaleric acid | ChEBI |
| (R)-3-hydroxyvaleric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721213 | Reaxys |
| CAS:53538-53-7 | ChemIDplus |
| Citations |
|---|