EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C18H21N3O5S2 |
| Net Charge | +1 |
| Average Mass | 424.524 |
| Monoisotopic Mass | 424.09954 |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)[C@H]1C(=O)NO.[H+] |
| InChI | InChI=1S/C18H21N3O5S2/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14/h3-10,16,23H,11-12H2,1-2H3,(H,20,22)/p+1/t16-/m0/s1 |
| InChIKey | YKPYIPVDTNNYCN-INIZCTEOSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prinomastat(1+) (CHEBI:138886) is a organic cation (CHEBI:25697) |
| prinomastat(1+) (CHEBI:138886) is conjugate acid of prinomastat (CHEBI:138885) |
| Incoming Relation(s) |
| prinomastat hydrochloride (CHEBI:138841) has part prinomastat(1+) (CHEBI:138886) |
| prinomastat (CHEBI:138885) is conjugate base of prinomastat(1+) (CHEBI:138886) |