EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O5S2.HCl |
| Net Charge | 0 |
| Average Mass | 459.977 |
| Monoisotopic Mass | 459.06894 |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)[C@H]1C(=O)NO.Cl |
| InChI | InChI=1S/C18H21N3O5S2.ClH/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14;/h3-10,16,23H,11-12H2,1-2H3,(H,20,22);1H/t16-;/m0./s1 |
| InChIKey | UQGWXXLNXBRNBU-NTISSMGPSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.35 (gelatinase B) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase B (EC 3.4.24.35). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prinomastat hydrochloride (CHEBI:138841) has part prinomastat(1+) (CHEBI:138886) |
| prinomastat hydrochloride (CHEBI:138841) has role antineoplastic agent (CHEBI:35610) |
| prinomastat hydrochloride (CHEBI:138841) has role EC 3.4.24.35 (gelatinase B) inhibitor (CHEBI:79088) |
| prinomastat hydrochloride (CHEBI:138841) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| prinomastat hydrochloride (CHEBI:138841) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3S)-N-hydroxy-2,2-dimethyl-4-{[4-(pyridin-4-yloxy)phenyl]sulfonyl}thiomorpholine-3-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| AG 3340 HCl | ChEBI |
| AG-3340 HCl | ChEBI |
| AG3340 HCl | ChEBI |
| AG 3340 hydrochloride | SUBMITTER |
| AG-3340 hydrochloride | ChEBI |
| AG3340 hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30263785 | Reaxys |
| CAS:1435779-45-5 | ChemIDplus |