EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CN(C)CCC(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-6(2)4-3-5(7)8/h3-4H2,1-2H3,(H,7,8) |
| InChIKey | JMOXSQYGVIXBBZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethyl-β-alanine (CHEBI:138668) has functional parent N-methyl-β-alanine (CHEBI:138669) |
| N,N-dimethyl-β-alanine (CHEBI:138668) is a tertiary amino compound (CHEBI:50996) |
| N,N-dimethyl-β-alanine (CHEBI:138668) is a β-amino acid (CHEBI:33706) |
| IUPAC Name |
|---|
| N,N-dimethyl-β-alanine |
| Synonyms | Source |
|---|---|
| 3-dimethylaminopropionic acid | ChEBI |
| 3-(dimethylamino)propanoic acid | IUPAC |
| 3-(dimethylamino)propionic acid | IUPAC |
| 3-dimethylaminopropanoic acid | ChEBI |
| 3-(N,N-dimethylamino)propionic acid | ChEBI |
| 3-(N,N-dimethylamino)propanoic acid | ChEBI |
| Citations |
|---|