EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O6 |
| Net Charge | -1 |
| Average Mass | 367.462 |
| Monoisotopic Mass | 367.21261 |
| SMILES | CC(O)CCC[C@H](O)/C=C/[C@H]1O[C@H]2C[C@H](O2)[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O6/c1-14(21)7-6-8-15(22)11-12-17-16(18-13-20(25-17)26-18)9-4-2-3-5-10-19(23)24/h2,4,11-12,14-18,20-22H,3,5-10,13H2,1H3,(H,23,24)/p-1/b4-2-,12-11+/t14?,15-,16+,17+,18-,20+/m0/s1 |
| InChIKey | WOQBOHYWWJRXPR-SVALGRSTSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxythromboxane A2(1−) (CHEBI:137988) has functional parent thromboxane A2(1−) (CHEBI:57445) |
| 19-hydroxythromboxane A2(1−) (CHEBI:137988) is a thromboxane anion (CHEBI:62945) |
| 19-hydroxythromboxane A2(1−) (CHEBI:137988) is conjugate base of 19-hydroxythromboxane A2 (CHEBI:138583) |
| Incoming Relation(s) |
| 19-hydroxythromboxane A2 (CHEBI:138583) is conjugate acid of 19-hydroxythromboxane A2(1−) (CHEBI:137988) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α-epoxy-15,19-dihydroxythromboxa-5,13-dien-1-oate |
| Synonym | Source |
|---|---|
| 19-hydroxy-TXA2(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 19-hydroxy-thromboxane A2 | UniProt |
| Citations |
|---|