EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7N5O |
| Net Charge | 0 |
| Average Mass | 141.134 |
| Monoisotopic Mass | 141.06506 |
| SMILES | Nc1nc(N)c(N)c(O)n1 |
| InChI | InChI=1S/C4H7N5O/c5-1-2(6)8-4(7)9-3(1)10/h5H2,(H5,6,7,8,9,10) |
| InChIKey | SYEYEGBZVSWYPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5,6-triamino-4-hydroxypyrimidine (CHEBI:137796) has role antioxidant (CHEBI:22586) |
| 2,5,6-triamino-4-hydroxypyrimidine (CHEBI:137796) has role chromophore (CHEBI:23240) |
| 2,5,6-triamino-4-hydroxypyrimidine (CHEBI:137796) is a aminopyrimidine (CHEBI:38338) |
| 2,5,6-triamino-4-hydroxypyrimidine (CHEBI:137796) is a hydroxypyrimidine (CHEBI:38340) |
| IUPAC Name |
|---|
| 2,5,6-triaminopyrimidin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 2,4,5-Triamino-6-pyrimidinol | ChemIDplus |
| 2,5,6-Triamino-4-pyrimidinol | ChemIDplus |
| 4-hydroxy-2,5,6-triaminopyrimidine | SUBMITTER |
| 6-Hydroxy-2,4,5-triaminopyrimidine | ChemIDplus |
| HTP | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2,5,6-triamino-4-hydroxypyrimidine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DE102005042052 | Patent |
| MX2007007921 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:744611 | Reaxys |
| CAS:1004-75-7 | ChemIDplus |
| Citations |
|---|