EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36N6O6S |
| Net Charge | 0 |
| Average Mass | 596.710 |
| Monoisotopic Mass | 596.24170 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C29H36N6O6S/c1-42-12-11-22(33-27(39)20(30)14-18-16-32-21-10-6-5-9-19(18)21)28(40)35-24(15-25(36)37)29(41)34-23(26(31)38)13-17-7-3-2-4-8-17/h2-10,16,20,22-24,32H,11-15,30H2,1H3,(H2,31,38)(H,33,39)(H,34,41)(H,35,40)(H,36,37)/t20-,22-,23-,24-/m0/s1 |
| InChIKey | RGYLYUZOGHTBRF-BIHRQFPBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27871026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | anxiogenic Any psychotropic drug that induces anxiety or panic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetragastrin (CHEBI:137728) has role anxiogenic (CHEBI:137736) |
| tetragastrin (CHEBI:137728) has role human metabolite (CHEBI:77746) |
| tetragastrin (CHEBI:137728) is a peptidyl amide (CHEBI:15722) |
| tetragastrin (CHEBI:137728) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-tryptophyl-L-methionyl-L-α-aspartyl-L-phenylalaninamide |
| Synonyms | Source |
|---|---|
| CCK-4 | ChEBI |
| CCRIS 3246 | ChemIDplus |
| cholecystokinin-4 | ChEBI |
| Cholecystokinin tetrapeptide | ChemIDplus |
| Gastrin tetrapeptide | ChemIDplus |
| Gastrin tetrapeptide amide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CCK-4 | Wikipedia |
| D01456 | KEGG DRUG |
| HMDB0005775 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24193542 | Reaxys |
| Reaxys:4223651 | Reaxys |
| CAS:1947-37-1 | ChemIDplus |
| Citations |
|---|