EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39N7O18P3SR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 838.591 |
| Monoisotopic Mass (excl. R groups) | 838.12851 |
| SMILES | *[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) is a (S)-3-hydroxyacyl-CoA (CHEBI:15455) |
| short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) is a 3-hydroxy fatty acyl-CoA (CHEBI:20060) |
| short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) is a short-chain fatty acyl-CoA (CHEBI:61905) |
| short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) is conjugate acid of short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) |
| Incoming Relation(s) |
| short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) is conjugate base of short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) |
| Synonym | Source |
|---|---|
| (3S)-short-chain hydroxy fatty acyl-CoA | ChEBI |