EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N7O18P3SR |
| Net Charge | -4 |
| Average Mass (excl. R groups) | 834.559 |
| Monoisotopic Mass (excl. R groups) | 834.09721 |
| SMILES | *[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) is a (S)-3-hydroxyacyl-CoA(4−) (CHEBI:57318) |
| short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) is a 3-hydroxy fatty acyl-CoA(4−) (CHEBI:65102) |
| short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) is a short chain fatty acyl-CoA(4−) (CHEBI:137040) |
| short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) is conjugate base of short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) |
| Incoming Relation(s) |
| (S)-3-hydroxybutanoyl-CoA(4−) (CHEBI:57316) is a short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) |
| (S)-3-hydroxypentanoyl-CoA(4−) (CHEBI:138607) is a short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) |
| short-chain (3S)-hydroxy fatty acyl-CoA (CHEBI:137650) is conjugate acid of short-chain (3S)-hydroxy fatty acyl-CoA(4−) (CHEBI:136760) |
| Synonym | Source |
|---|---|
| (3S)-short-chain hydroxy fatty acyl-CoA(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| a short-chain (3S)-3-hydroxyacyl-CoA | UniProt |