EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N5O6 |
| Net Charge | 0 |
| Average Mass | 391.384 |
| Monoisotopic Mass | 391.14918 |
| SMILES | CNc1cc2c(cc1C)nc1c(=O)nc(=O)nc-1n2C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H21N5O6/c1-7-3-9-10(4-8(7)18-2)22(5-11(24)14(26)12(25)6-23)15-13(19-9)16(27)21-17(28)20-15/h3-4,11-12,14,18,23-26H,5-6H2,1-2H3,(H,21,27,28)/t11-,12+,14-/m0/s1 |
| InChIKey | PWZSYWZSTDXLFL-SCRDCRAPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) has functional parent riboflavin (CHEBI:17015) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is a aromatic amine (CHEBI:33860) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is a benzopteridine (CHEBI:38925) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is a secondary amino compound (CHEBI:50995) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is a tetrol (CHEBI:33573) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is conjugate acid of 8-demethyl-8-(methylamino)riboflavin(1−) (CHEBI:136520) |
| Incoming Relation(s) |
| 8-demethyl-8-(methylamino)riboflavin(1−) (CHEBI:136520) is conjugate base of 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) |
| IUPAC Name |
|---|
| 1-deoxy-1-[7-methyl-8-(methylamino)-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl]-D-ribitol |
| Synonyms | Source |
|---|---|
| 8-demethyl-8-methylaminoriboflavin | ChEBI |
| 8-Methylamino-riboflavin | ChemIDplus |
| 8-Methylaminoriboflavin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-19834 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1231598 | Reaxys |
| CAS:62746-55-8 | ChemIDplus |
| Citations |
|---|