EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N5O6 |
| Net Charge | -1 |
| Average Mass | 390.376 |
| Monoisotopic Mass | 390.14191 |
| SMILES | CNc1cc2c(cc1C)nc1c(=O)[n-]c(=O)nc-1n2C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C17H21N5O6/c1-7-3-9-10(4-8(7)18-2)22(5-11(24)14(26)12(25)6-23)15-13(19-9)16(27)21-17(28)20-15/h3-4,11-12,14,23-26H,5-6H2,1-2H3,(H2,18,20,21,27,28)/p-1/t11-,12+,14-/m0/s1 |
| InChIKey | MLEQSFGNEBXTPY-SCRDCRAPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-demethyl-8-(methylamino)riboflavin(1−) (CHEBI:136520) is a organic anion (CHEBI:25696) |
| 8-demethyl-8-(methylamino)riboflavin(1−) (CHEBI:136520) is conjugate base of 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) |
| Incoming Relation(s) |
| 8-demethyl-8-(methylamino)riboflavin (CHEBI:137340) is conjugate acid of 8-demethyl-8-(methylamino)riboflavin(1−) (CHEBI:136520) |
| IUPAC Name |
|---|
| 1-deoxy-1-[7-methyl-8-(methylamino)-2,4-dioxo-2H-benzo[g]pteridin-3-id-10(4H)-yl]-D-ribitol |
| Synonym | Source |
|---|---|
| 8-demethyl-8-methylaminoriboflavin(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 8-demethyl-8-(methylamino)riboflavin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19834 | MetaCyc |
| Citations |
|---|