EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:137081 - CORM 3
| Formula | C5H4ClNO5Ru |
| Net Charge | 0 |
| Average Mass | 294.612 |
| Monoisotopic Mass | 294.88215 |
| SMILES | O=C1C[NH2+][Ru-4]([Cl])([C]#[O+])([C]#[O+])([C]#[O+])[O]1 |
| InChI | InChI=1S/C2H5NO2.3CO.ClH.Ru/c3-1-2(4)5;3*1-2;;/h1,3H2,(H,4,5);;;;1H;/q;3*+1;;-1/p-2 |
| InChIKey | KNIGBBVETQCJTQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 1.11.2.2 (myeloperoxidase) inhibitor An EC 1.11.2.* (oxidoreductase with H2O2 as acceptor, incorporating 1 O atom into product) inhibitor that interferes with the action of myeloperoxidase (EC 1.11.2.2). |
| Applications: | anticoagulant An agent that prevents blood clotting. anti-inflammatory agent Any compound that has anti-inflammatory effects. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CORM 3 (CHEBI:137081) has role anti-inflammatory agent (CHEBI:67079) |
| CORM 3 (CHEBI:137081) has role antibacterial agent (CHEBI:33282) |
| CORM 3 (CHEBI:137081) has role anticoagulant (CHEBI:50249) |
| CORM 3 (CHEBI:137081) has role EC 1.11.2.2 (myeloperoxidase) inhibitor (CHEBI:79093) |
| CORM 3 (CHEBI:137081) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| CORM 3 (CHEBI:137081) has role nephroprotective agent (CHEBI:76595) |
| CORM 3 (CHEBI:137081) has role neuroprotective agent (CHEBI:63726) |
| CORM 3 (CHEBI:137081) is a metal carbonyl (CHEBI:36604) |
| CORM 3 (CHEBI:137081) is a ruthenium coordination entity (CHEBI:35733) |
| IUPAC Name |
|---|
| tricarbonyl(chloro)(glycinato-κ2N,O)ruthenium |
| Synonyms | Source |
|---|---|
| Carbon monoxide releasing molecule 3 | SUBMITTER |
| Tricarbonylchloro(glycinato)ruthenium | SUBMITTER |
| CORM-3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24025482 | Reaxys |
| Citations |
|---|