EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | N[C@@H](CN[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c9-4(7(13)14)3-10-5(8(15)16)1-2-6(11)12/h4-5,10H,1-3,9H2,(H,11,12)(H,13,14)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | XYQHCOGLGSNTNV-WHFBIAKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus aureus (ncbitaxon:1280) | - | PubMed (24485762) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) has role bacterial metabolite (CHEBI:76969) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) is a L-glutamic acid derivative (CHEBI:83982) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) is a tricarboxylic acid (CHEBI:27093) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) is conjugate acid of N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate(2−) (CHEBI:134610) |
| Incoming Relation(s) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate(2−) (CHEBI:134610) is conjugate base of N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) |
| IUPAC Name |
|---|
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid |
| Synonym | Source |
|---|---|
| N-[(2S)-2-amino-2-carboxyethyl]glutamic acid | ChEBI |
| Citations |
|---|