EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O6 |
| Net Charge | -2 |
| Average Mass | 232.192 |
| Monoisotopic Mass | 232.07063 |
| SMILES | N[C@@H](C[NH2+][C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H14N2O6/c9-4(7(13)14)3-10-5(8(15)16)1-2-6(11)12/h4-5,10H,1-3,9H2,(H,11,12)(H,13,14)(H,15,16)/p-2/t4-,5-/m0/s1 |
| InChIKey | XYQHCOGLGSNTNV-WHFBIAKZSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate(2−) (CHEBI:134610) is a tricarboxylic acid dianion (CHEBI:36300) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate(2−) (CHEBI:134610) is conjugate base of N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) |
| Incoming Relation(s) |
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid (CHEBI:136987) is conjugate acid of N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate(2−) (CHEBI:134610) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-amino-2-carboxylatoethyl]azaniumyl}pentanedioate |
| UniProt Name | Source |
|---|---|
| N-[(2S)-2-amino-2-carboxyethyl]-L-glutamate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19754 | MetaCyc |
| Citations |
|---|