EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | CC1=CC(O)CC(C)(C)C1(O)/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,12,16,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7+ |
| InChIKey | MWGXQVSTMXPXIW-WEYXYWBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans-4'-dihydroabscisic acid (CHEBI:136934) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 2-trans-4'-dihydroabscisic acid (CHEBI:136934) is a apo carotenoid sesquiterpenoid (CHEBI:36758) |
| 2-trans-4'-dihydroabscisic acid (CHEBI:136934) is a secondary allylic alcohol (CHEBI:134396) |
| 2-trans-4'-dihydroabscisic acid (CHEBI:136934) is a tertiary allylic alcohol (CHEBI:134397) |
| 2-trans-4'-dihydroabscisic acid (CHEBI:136934) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| 4'-dihydroabscisic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 14923529 | ChemSpider |
| HMDB0039516 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2946155 | Reaxys |
| CAS:84026-26-6 | HMDB |