EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O5 |
| Net Charge | 0 |
| Average Mass | 368.429 |
| Monoisotopic Mass | 368.16237 |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2ccc(O)cc2)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C22H24O5/c1-14(2)5-11-17-19(26-3)13-20(27-4)21(22(17)25)18(24)12-8-15-6-9-16(23)10-7-15/h5-10,12-13,23,25H,11H2,1-4H3/b12-8+ |
| InChIKey | UVBDKJHYMQEAQV-XYOKQWHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus var. cordifolius (ncbitaxon:278022) | - | PubMed (10783982) |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylxanthohumol (CHEBI:136828) has functional parent trans-chalcone (CHEBI:48965) |
| 4'-O-methylxanthohumol (CHEBI:136828) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| 4'-O-methylxanthohumol (CHEBI:136828) is a aromatic ether (CHEBI:35618) |
| 4'-O-methylxanthohumol (CHEBI:136828) is a chalcones (CHEBI:23086) |
| 4'-O-methylxanthohumol (CHEBI:136828) is a polyphenol (CHEBI:26195) |
| 4'-O-methylxanthohumol (CHEBI:136828) is conjugate acid of 4'-O-methylxanthohumol(1−) (CHEBI:134309) |
| Incoming Relation(s) |
| 4'-O-methylxanthohumol(1−) (CHEBI:134309) is conjugate base of 4'-O-methylxanthohumol (CHEBI:136828) |
| IUPAC Name |
|---|
| (2E)-1-[2-hydroxy-4,6-dimethoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 4'-methylxanthohumol | ChEBI |
| 3'-(isoprenyl)-2',4-dihydroxy-4',6'-dimethoxychalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120318 | LIPID MAPS |
| C00007100 | KNApSAcK |
| CPD-7122 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6983932 | Reaxys |
| CAS:123316-63-2 | KNApSAcK |
| Citations |
|---|