EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23O5 |
| Net Charge | -1 |
| Average Mass | 367.421 |
| Monoisotopic Mass | 367.15510 |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2ccc(O)cc2)c([O-])c1CC=C(C)C |
| InChI | InChI=1S/C22H24O5/c1-14(2)5-11-17-19(26-3)13-20(27-4)21(22(17)25)18(24)12-8-15-6-9-16(23)10-7-15/h5-10,12-13,23,25H,11H2,1-4H3/p-1/b12-8+ |
| InChIKey | UVBDKJHYMQEAQV-XYOKQWHBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylxanthohumol(1−) (CHEBI:134309) is a phenolate anion (CHEBI:50525) |
| 4'-O-methylxanthohumol(1−) (CHEBI:134309) is conjugate base of 4'-O-methylxanthohumol (CHEBI:136828) |
| Incoming Relation(s) |
| 4'-O-methylxanthohumol (CHEBI:136828) is conjugate acid of 4'-O-methylxanthohumol(1−) (CHEBI:134309) |
| IUPAC Name |
|---|
| 2-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-3,5-dimethoxy-6-(3-methylbut-2-en-1-yl)phenolate |
| Synonym | Source |
|---|---|
| 4'-methylxanthohumol(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 4'-O-methylxanthohumol | UniProt |
| Citations |
|---|