EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1cc(O)c(C(=O)/C=C/c2ccc(O)cc2)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-10-16-19(26-3)12-18(24)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/b11-7+ |
| InChIKey | ALGFNVZQNNGHPA-YRNVUSSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus var. cordifolius (ncbitaxon:278022) | - | PubMed (10783982) | |
| Drynaria fortunei (ncbitaxon:272675) | - | PubMed (21377852) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthogalenol (CHEBI:136826) has functional parent trans-chalcone (CHEBI:48965) |
| xanthogalenol (CHEBI:136826) has role bone density conservation agent (CHEBI:50646) |
| xanthogalenol (CHEBI:136826) has role plant metabolite (CHEBI:76924) |
| xanthogalenol (CHEBI:136826) is a aromatic ether (CHEBI:35618) |
| xanthogalenol (CHEBI:136826) is a chalcones (CHEBI:23086) |
| xanthogalenol (CHEBI:136826) is a polyphenol (CHEBI:26195) |
| xanthogalenol (CHEBI:136826) is conjugate acid of xanthogalenol(1−) (CHEBI:134308) |
| Incoming Relation(s) |
| xanthogalenol(1−) (CHEBI:134308) is conjugate base of xanthogalenol (CHEBI:136826) |
| IUPAC Name |
|---|
| (2E)-1-[2,6-dihydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 3' prenyl-4' O-methylchalconaringenin | ChEBI |
| 3'-Prenyl-4,2',6'-trihydroxy-4'-methoxychalcone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120307 | LIPID MAPS |
| C00014475 | KNApSAcK |
| HMDB0035002 | HMDB |
| CPD-7121 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8581475 | Reaxys |
| CAS:265659-35-6 | KNApSAcK |
| Citations |
|---|