EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21O5 |
| Net Charge | -1 |
| Average Mass | 353.394 |
| Monoisotopic Mass | 353.13945 |
| SMILES | COc1cc(O)c(C(=O)/C=C/c2ccc(O)cc2)c([O-])c1CC=C(C)C |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-10-16-19(26-3)12-18(24)20(21(16)25)17(23)11-7-14-5-8-15(22)9-6-14/h4-9,11-12,22,24-25H,10H2,1-3H3/p-1/b11-7+ |
| InChIKey | ALGFNVZQNNGHPA-YRNVUSSQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthogalenol(1−) (CHEBI:134308) is a phenolate anion (CHEBI:50525) |
| xanthogalenol(1−) (CHEBI:134308) is conjugate base of xanthogalenol (CHEBI:136826) |
| Incoming Relation(s) |
| xanthogalenol (CHEBI:136826) is conjugate acid of xanthogalenol(1−) (CHEBI:134308) |
| IUPAC Name |
|---|
| 3-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-methoxy-6-(3-methylbut-2-en-1-yl)phenolate |
| Synonym | Source |
|---|---|
| 3' prenyl-4' O-methylchalconaringenin(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| xanthogalenol | UniProt |
| Citations |
|---|