EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H45NO3 |
| Net Charge | 0 |
| Average Mass | 395.628 |
| Monoisotopic Mass | 395.33994 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C24H45NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-22(24(27)28)20-21(2)3/h11-12,21-22H,4-10,13-20H2,1-3H3,(H,25,26)(H,27,28)/b12-11-/t22-/m0/s1 |
| InChIKey | UMOAAMQGRRCHPA-GJCOWUBNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-leucine (CHEBI:136616) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-leucine (CHEBI:136616) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-oleoyl-L-leucine (CHEBI:136616) is a L-leucine derivative (CHEBI:25018) |
| N-oleoyl-L-leucine (CHEBI:136616) is conjugate acid of N-oleoyl-L-leucinate (CHEBI:134035) |
| Incoming Relation(s) |
| N-oleoyl-L-leucinate (CHEBI:134035) is conjugate base of N-oleoyl-L-leucine (CHEBI:136616) |
| IUPAC Name |
|---|
| N2-[(9Z)-octadec-9-enoyl]-L-leucine |
| Synonyms | Source |
|---|---|
| (2S)-4-methyl-2-{[(9Z)-octadec-9-enoyl]amino}pentanoic acid | IUPAC |
| N-[(9Z)-octadecenoyl]leucine | ChEBI |
| N-(9Z-octadecenoyl)-L-leucine | ChEBI |
| N-[(9Z)-octadecenoyl]-L-leucine | ChEBI |
| N-oleoylleucine | ChEBI |
| oleoylleucine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2155489 | Reaxys |
| Citations |
|---|