EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H44NO3 |
| Net Charge | -1 |
| Average Mass | 394.620 |
| Monoisotopic Mass | 394.33267 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C24H45NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-22(24(27)28)20-21(2)3/h11-12,21-22H,4-10,13-20H2,1-3H3,(H,25,26)(H,27,28)/p-1/b12-11-/t22-/m0/s1 |
| InChIKey | UMOAAMQGRRCHPA-GJCOWUBNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-leucinate (CHEBI:134035) is a N-(fatty acyl)-L-leucine(1−) (CHEBI:149740) |
| N-oleoyl-L-leucinate (CHEBI:134035) is a N-(fatty acyl)-L-α-amino acid anion (CHEBI:136716) |
| N-oleoyl-L-leucinate (CHEBI:134035) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-oleoyl-L-leucinate (CHEBI:134035) is conjugate base of N-oleoyl-L-leucine (CHEBI:136616) |
| Incoming Relation(s) |
| N-oleoyl-L-leucine (CHEBI:136616) is conjugate acid of N-oleoyl-L-leucinate (CHEBI:134035) |
| IUPAC Name |
|---|
| (2S)-4-methyl-2-{[(9Z)-octadec-9-enoyl]amino}pentanoate |
| Synonyms | Source |
|---|---|
| N-(9Z-octadecenoyl)-L-leucinate | ChEBI |
| N-[(9Z)-octadecenoyl]leucinate | ChEBI |
| oleoylleucinate | ChEBI |
| N-oleoylleucinate | ChEBI |
| N-[(9Z)-octadecenoyl]-L-leucinate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(9Z-octadecenoyl)-L-leucine | UniProt |
| Citations |
|---|