EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H42N2O4 |
| Net Charge | 0 |
| Average Mass | 410.599 |
| Monoisotopic Mass | 410.31446 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H42N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)25-20(23(28)29)18-19-21(24)26/h9-10,20H,2-8,11-19H2,1H3,(H2,24,26)(H,25,27)(H,28,29)/b10-9-/t20-/m0/s1 |
| InChIKey | ZHVSXWCIYWYBQP-QJRAZLAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-glutamine (CHEBI:136615) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-glutamine (CHEBI:136615) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-oleoyl-L-glutamine (CHEBI:136615) is a L-glutamine derivative (CHEBI:24317) |
| N-oleoyl-L-glutamine (CHEBI:136615) is conjugate acid of N-oleoyl-L-glutaminate (CHEBI:134033) |
| Incoming Relation(s) |
| N-oleoyl-L-glutaminate (CHEBI:134033) is conjugate base of N-oleoyl-L-glutamine (CHEBI:136615) |
| IUPAC Name |
|---|
| N2-[(9Z)-octadec-9-enoyl]-L-glutamine |
| Synonyms | Source |
|---|---|
| N-(9Z-octadecenoyl)-L-glutamine | ChEBI |
| N-oleoylglutamine | ChEBI |
| N-[(9Z)-octadecenoyl]-L-glutamine | ChEBI |
| N-[(9Z)-octadecenoyl]glutamine | ChEBI |
| oleoylglutamine | ChEBI |
| (2S)-5-amino-2-{[(9Z)-octadec-9-enoyl]amino}-5-oxopentanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020128 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8367401 | Reaxys |
| Citations |
|---|