EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41N2O4 |
| Net Charge | -1 |
| Average Mass | 409.591 |
| Monoisotopic Mass | 409.30718 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C23H42N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)25-20(23(28)29)18-19-21(24)26/h9-10,20H,2-8,11-19H2,1H3,(H2,24,26)(H,25,27)(H,28,29)/p-1/b10-9-/t20-/m0/s1 |
| InChIKey | ZHVSXWCIYWYBQP-QJRAZLAKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-glutaminate (CHEBI:134033) is a N-(fatty acyl)-L-glutamine(1−) (CHEBI:149743) |
| N-oleoyl-L-glutaminate (CHEBI:134033) is a N-(fatty acyl)-L-α-amino acid anion (CHEBI:136716) |
| N-oleoyl-L-glutaminate (CHEBI:134033) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-oleoyl-L-glutaminate (CHEBI:134033) is conjugate base of N-oleoyl-L-glutamine (CHEBI:136615) |
| Incoming Relation(s) |
| N-oleoyl-L-glutamine (CHEBI:136615) is conjugate acid of N-oleoyl-L-glutaminate (CHEBI:134033) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-{[(9Z)-octadec-9-enoyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| N-oleoylglutaminate | ChEBI |
| N-(9Z-octadecenoyl)-L-glutaminate | ChEBI |
| oleoylglutaminate | ChEBI |
| N-[(9Z)-octadecenoyl]-L-glutaminate | ChEBI |
| N-[(9Z)-octadecenoyl]glutaminate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(9Z-octadecenoyl)-L-glutamine | UniProt |
| Citations |
|---|