EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18ClN7O |
| Net Charge | 0 |
| Average Mass | 299.766 |
| Monoisotopic Mass | 299.12614 |
| SMILES | CCN(c1nc(N)c(C(=O)NC(=N)N)nc1Cl)C(C)C |
| InChI | InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | QDERNBXNXJCIQK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylisopropylamiloride (CHEBI:136538) has functional parent amiloride (CHEBI:2639) |
| ethylisopropylamiloride (CHEBI:136538) has role anti-arrhythmia drug (CHEBI:38070) |
| ethylisopropylamiloride (CHEBI:136538) has role neuroprotective agent (CHEBI:63726) |
| ethylisopropylamiloride (CHEBI:136538) has role sodium channel blocker (CHEBI:38633) |
| ethylisopropylamiloride (CHEBI:136538) is a aromatic amine (CHEBI:33860) |
| ethylisopropylamiloride (CHEBI:136538) is a guanidines (CHEBI:24436) |
| ethylisopropylamiloride (CHEBI:136538) is a monocarboxylic acid amide (CHEBI:29347) |
| ethylisopropylamiloride (CHEBI:136538) is a organochlorine compound (CHEBI:36683) |
| ethylisopropylamiloride (CHEBI:136538) is a pyrazines (CHEBI:38314) |
| ethylisopropylamiloride (CHEBI:136538) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-amino-N-carbamimidoyl-6-chloro-5-[ethyl(isopropyl)amino]pyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 3-amino-N-(aminoiminomethyl)-6-chloro-5-(ethyl(1-methylethyl)amino)pyrazinecarboxamide | ChemIDplus |
| 5-(N-ethyl-N-isopropyl)amiloride | ChemIDplus |
| 5-(ethylisopropyl)amiloride | ChemIDplus |
| EIPA | ChemIDplus |
| N-amidino-3-amino-5-ethylisopropylamino-6-chloropyrazine carboxamide | ChemIDplus |
| ethyl isopropyl amiloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1154-25-2 | ChemIDplus |
| Citations |
|---|