EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18ClN7O |
| Net Charge | 0 |
| Average Mass | 299.766 |
| Monoisotopic Mass | 299.12614 |
| SMILES | CCN(c1nc(N)c(C(=O)NC(=N)N)nc1Cl)C(C)C |
| InChI | InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | QDERNBXNXJCIQK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylisopropylamiloride (CHEBI:136538) has functional parent amiloride (CHEBI:2639) |
| ethylisopropylamiloride (CHEBI:136538) has role anti-arrhythmia drug (CHEBI:38070) |
| ethylisopropylamiloride (CHEBI:136538) has role neuroprotective agent (CHEBI:63726) |
| ethylisopropylamiloride (CHEBI:136538) has role sodium channel blocker (CHEBI:38633) |
| ethylisopropylamiloride (CHEBI:136538) is a aromatic amine (CHEBI:33860) |
| ethylisopropylamiloride (CHEBI:136538) is a guanidines (CHEBI:24436) |
| ethylisopropylamiloride (CHEBI:136538) is a monocarboxylic acid amide (CHEBI:29347) |
| ethylisopropylamiloride (CHEBI:136538) is a organochlorine compound (CHEBI:36683) |
| ethylisopropylamiloride (CHEBI:136538) is a pyrazines (CHEBI:38314) |
| ethylisopropylamiloride (CHEBI:136538) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-amino-N-carbamimidoyl-6-chloro-5-[ethyl(isopropyl)amino]pyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 5-(N-ethyl-N-isopropyl)amiloride | ChemIDplus |
| 3-amino-N-(aminoiminomethyl)-6-chloro-5-(ethyl(1-methylethyl)amino)pyrazinecarboxamide | ChemIDplus |
| N-amidino-3-amino-5-ethylisopropylamino-6-chloropyrazine carboxamide | ChemIDplus |
| 5-(ethylisopropyl)amiloride | ChemIDplus |
| ethyl isopropyl amiloride | ChemIDplus |
| EIPA | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1154-25-2 | ChemIDplus |
| Citations |
|---|