EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29N3O6 |
| Net Charge | 0 |
| Average Mass | 479.533 |
| Monoisotopic Mass | 479.20564 |
| SMILES | [H][C@]1(c2cccc([N+](=O)[O-])c2)C(C(=O)OC)=C(C)NC(C)=C1C(=O)OCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O6/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19/h5-12,15,24,27H,13-14,16H2,1-4H3/t24-/m0/s1 |
| InChIKey | ZBBHBTPTTSWHBA-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nicardipine (CHEBI:135777) has role antihypertensive agent (CHEBI:35674) |
| (S)-nicardipine (CHEBI:135777) has role calcium channel blocker (CHEBI:38215) |
| (S)-nicardipine (CHEBI:135777) is a 2-[benzyl(methyl)amino]ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CHEBI:180905) |
| (S)-nicardipine (CHEBI:135777) is enantiomer of (R)-nicardipine (CHEBI:180904) |
| Incoming Relation(s) |
| nicardipine (CHEBI:7550) has part (S)-nicardipine (CHEBI:135777) |
| (R)-nicardipine (CHEBI:180904) is enantiomer of (S)-nicardipine (CHEBI:135777) |
| IUPAC Name |
|---|
| 2-[benzyl(methyl)amino]ethyl methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Synonyms | Source |
|---|---|
| S-(+)-nicardipine | ChEBI |
| (S)-YC-93 free base | ChEBI |
| (+)-nicardipine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:76093-36-2 | ChemIDplus |
| Citations |
|---|