EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O8 |
| Net Charge | 0 |
| Average Mass | 460.523 |
| Monoisotopic Mass | 460.20972 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCC(=O)O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H32O8/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30/h7,9,11,16-18,22,27,32H,3-6,8,10,12-13H2,1-2H3,(H,29,30)/t16-,17-,18-,22+,23-,24-,25-/m0/s1 |
| InChIKey | APGDTXUMTIZLCJ-CGVGKPPMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prednisolone succinate (CHEBI:135745) has functional parent prednisolone (CHEBI:8378) |
| prednisolone succinate (CHEBI:135745) has functional parent succinic acid (CHEBI:15741) |
| prednisolone succinate (CHEBI:135745) has role anti-inflammatory drug (CHEBI:35472) |
| prednisolone succinate (CHEBI:135745) is a 11β-hydroxy steroid (CHEBI:35346) |
| prednisolone succinate (CHEBI:135745) is a 17α-hydroxy steroid (CHEBI:35342) |
| prednisolone succinate (CHEBI:135745) is a 20-oxo steroid (CHEBI:36885) |
| prednisolone succinate (CHEBI:135745) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| prednisolone succinate (CHEBI:135745) is a hemisuccinate (CHEBI:138979) |
| prednisolone succinate (CHEBI:135745) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| prednisolone succinate (CHEBI:135745) is conjugate acid of prednisolone succinate(1−) (CHEBI:157677) |
| Incoming Relation(s) |
| prednisolone succinate(1−) (CHEBI:157677) is conjugate base of prednisolone succinate (CHEBI:135745) |
| IUPAC Name |
|---|
| 4-[(11β,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl)oxy]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| prednisolone hemisuccinate | ChemIDplus |
| prednisolone bisuccinate | ChemIDplus |
| prednisolone 21-succinate | ChemIDplus |
| prednisolone 21-hemisuccinate | ChemIDplus |
| prednisolone 21-(hydrogen succinate) | ChemIDplus |
| 11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione 21-hemisuccinate | ChEBI |
| Brand Name | Source |
|---|---|
| Prednisolut | ChemIDplus |
| Citations |
|---|