EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O5 |
| Net Charge | 0 |
| Average Mass | 312.406 |
| Monoisotopic Mass | 312.19367 |
| SMILES | [H][C@]12O[C@H](OCC)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C17H28O5/c1-5-18-14-11(3)13-7-6-10(2)12-8-9-16(4)20-15(19-14)17(12,13)22-21-16/h10-15H,5-9H2,1-4H3/t10-,11-,12+,13+,14+,15-,16-,17-/m1/s1 |
| InChIKey | NLYNIRQVMRLPIQ-XQLAAWPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artemotil (CHEBI:135335) has role antimalarial (CHEBI:38068) |
| artemotil (CHEBI:135335) is a artemisinin derivative (CHEBI:63920) |
| INN | Source |
|---|---|
| artemotilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| arteether | DrugCentral |
| Artemotil | ChEMBL |
| Artemotilum | ChEMBL |
| .beta.-arteether | ChEMBL |
| dihydroartemisinin ethyl ether | DrugCentral |
| dihydroqinghaosu ethyl ether | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 246 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:75887-54-6 | DrugCentral |
| Citations |
|---|