EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O4S2 |
| Net Charge | 0 |
| Average Mass | 284.363 |
| Monoisotopic Mass | 284.06130 |
| SMILES | O=S1(=O)CCN(CN2CCS(=O)(=O)NC2)CN1 |
| InChI | InChI=1S/C7H16N4O4S2/c12-16(13)3-1-10(5-8-16)7-11-2-4-17(14,15)9-6-11/h8-9H,1-7H2 |
| InChIKey | AJKIRUJIDFJUKJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taurolidine (CHEBI:135173) has role anti-inflammatory agent (CHEBI:67079) |
| taurolidine (CHEBI:135173) has role antibacterial agent (CHEBI:33282) |
| taurolidine (CHEBI:135173) has role antifungal agent (CHEBI:35718) |
| taurolidine (CHEBI:135173) has role antineoplastic agent (CHEBI:35610) |
| taurolidine (CHEBI:135173) has role antiseptic drug (CHEBI:48218) |
| taurolidine (CHEBI:135173) is a sulfone (CHEBI:35850) |
| taurolidine (CHEBI:135173) is a thiadiazinane (CHEBI:38781) |
| Incoming Relation(s) |
| Defencath (CHEBI:230518) has part taurolidine (CHEBI:135173) |
| IUPAC Name |
|---|
| 4,4'-methanediylbis(1,2,4-thiadiazinane) 1,1,1',1'-tetraoxide |
| INNs | Source |
|---|---|
| taurolidina | WHO MedNet |
| taurolidine | WHO MedNet |
| taurolidine | WHO MedNet |
| taurolidinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4,4'-methylenebis(1,2,4-thiadiazinane)-1,1,1',1'-tetraoxide | ChEBI |
| 4,4'-methylenebis(perhydro-1,2,4-thiadiazin 1,1-dioxide) | ChEBI |
| 4,4'-methylenedi(1λ6,2,4-thiadiazinane-1,1-dione) | IUPAC |
| taurolin | DrugCentral |
| tauroline | DrugCentral |
| W-3100M | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2568 | DrugCentral |
| D07146 | KEGG DRUG |
| DB12473 | DrugBank |
| HMDB0258744 | HMDB |
| Taurolidine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:19388-87-5 | KEGG DRUG |
| Citations |
|---|