EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | C=C(C#N)C(=O)OCCCC |
| InChI | InChI=1S/C8H11NO2/c1-3-4-5-11-8(10)7(2)6-9/h2-5H2,1H3 |
| InChIKey | JJJFUHOGVZWXNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enbucrilate (CHEBI:134778) is a nitrile (CHEBI:18379) |
| enbucrilate (CHEBI:134778) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Synonyms | Source |
|---|---|
| butyl alpha-cyanoacrylate | DrugCentral |
| butyl cyanoacrylate | DrugCentral |
| histacryl blue | DrugCentral |
| indermil | DrugCentral |
| n-Butyl 2-cyanoacrylate | DrugCentral |
| n-butyl cyanoacrylate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3056 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:6606-65-1 | DrugCentral |