EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33NO7S |
| Net Charge | -2 |
| Average Mass | 467.584 |
| Monoisotopic Mass | 467.19887 |
| SMILES | [NH3+][C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)[O-])[C@@H](O)CCCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/p-2/b4-2-,5-3-,8-6+,14-10+/t18-,19-,20+/m0/s1 |
| InChIKey | HVLRBLGTGJGVCX-SKJZCNKWSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-carboxyleukotriene E4(2−) (CHEBI:133439) is a leukotriene anion (CHEBI:62942) |
| 20-carboxyleukotriene E4(2−) (CHEBI:133439) is a tricarboxylic acid dianion (CHEBI:36300) |
| 20-carboxyleukotriene E4(2−) (CHEBI:133439) is conjugate base of 20-carboxyleukotriene E4 (CHEBI:134517) |
| Incoming Relation(s) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is conjugate acid of 20-carboxyleukotriene E4(2−) (CHEBI:133439) |
| IUPAC Name |
|---|
| (6Z,9Z,11E,13E,15R,16S)-15-{[(2R)-2-azaniumyl-2-carboxylatoethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioate |
| Synonyms | Source |
|---|---|
| 20-carboxy-leukotriene E4(2−) | ChEBI |
| 20-COOH-leukotriene E4(2−) | ChEBI |
| 20-carboxy-LTE4(2−) | ChEBI |