EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34NO6S |
| Net Charge | -1 |
| Average Mass | 452.593 |
| Monoisotopic Mass | 452.21123 |
| SMILES | [NH3+][C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC=O)[C@@H](O)CCCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C23H35NO6S/c24-19(23(29)30)18-31-21(20(26)14-13-16-22(27)28)15-11-9-7-5-3-1-2-4-6-8-10-12-17-25/h2-5,7,9,11,15,17,19-21,26H,1,6,8,10,12-14,16,18,24H2,(H,27,28)(H,29,30)/p-1/b4-2-,5-3-,9-7+,15-11+/t19-,20-,21+/m0/s1 |
| InChIKey | DXFWBOQUFGDWDP-CMJQBAFXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-oxoleukotriene E4(1−) (CHEBI:133433) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 20-oxoleukotriene E4(1−) (CHEBI:133433) is a leukotriene anion (CHEBI:62942) |
| 20-oxoleukotriene E4(1−) (CHEBI:133433) is conjugate base of 20-oxoleukotriene E4 (CHEBI:134513) |
| Incoming Relation(s) |
| 20-oxoleukotriene E4 (CHEBI:134513) is conjugate acid of 20-oxoleukotriene E4(1−) (CHEBI:133433) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z,14Z)-6-{[(2R)-2-azaniumyl-2-carboxylatoethyl]sulfanyl}-5-hydroxy-20-oxoicosa-7,9,11,14-tetraenoate |
| Synonym | Source |
|---|---|
| 20-oxo-LTE4(1−) | ChEBI |